C7H10OS — CID 135325566
3,3a,4,5-tetrahydro-2H-thieno[2,3-c]pyran (PubChem CID 135325566) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is 3,3a,4,5-tetrahydro-2H-thieno[2,3-c]pyran.
| Compound Name | 3,3a,4,5-tetrahydro-2H-thieno[2,3-c]pyran |
|---|---|
| PubChem CID | 135325566 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 3,3a,4,5-tetrahydro-2H-thieno[2,3-c]pyran |
| SMILES | C1=C2SCCC2CCO1 |
| InChI | InChI=1S/C7H10OS/c1-3-8-5-7-6(1)2-4-9-7/h5-6H,1-4H2 |
| InChIKey | RLODDZPMRUTACE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |