About Iobenguane I-123
Iobenguane I-123 (PubChem CID 135326) has the molecular formula C8H10IN3
and a molecular weight of 271.09 g/mol. Its IUPAC name is 2-[(3-(123I)iodophenyl)methyl]guanidine.
Molecular Properties
| Compound Name | Iobenguane I-123 |
| PubChem CID | 135326 |
| Molecular Formula | C8H10IN3 |
| Molecular Weight | 271.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2-[(3-(123I)iodophenyl)methyl]guanidine |
| SMILES | C1=CC(=CC(=C1)[123I])CN=C(N)N |
| InChI | InChI=1S/C8H10IN3/c9-7-3-1-2-6(4-7)5-12-8(10)11/h1-4H,5H2,(H4,10,11,12)/i9-4 |
| InChIKey | PDWUPXJEEYOOTR-IUAIQHPESA-N |
| XLogP | 1.00 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 166 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.09 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze Iobenguane I-123 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Iobenguane I-123?
The IUPAC name of Iobenguane I-123 (CID 135326) is 2-[(3-(123I)iodophenyl)methyl]guanidine.
What is the SMILES notation for Iobenguane I-123?
The canonical SMILES for Iobenguane I-123 is C1=CC(=CC(=C1)[123I])CN=C(N)N.
What is the InChIKey of Iobenguane I-123?
The InChIKey is PDWUPXJEEYOOTR-IUAIQHPESA-N. The full InChI is InChI=1S/C8H10IN3/c9-7-3-1-2-6(4-7)5-12-8(10)11/h1-4H,5H2,(H4,10,11,12)/i9-4.
What are the key properties of Iobenguane I-123?
Iobenguane I-123 has a molecular weight of 271.09 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Iobenguane I-123 is sourced from PubChem (CID 135326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).