C7H4F6N2S2 — CID 135329154
2,2,2-trifluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethanethioamide (PubChem CID 135329154) has the molecular formula C7H4F6N2S2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethanethioamide.
| Compound Name | 2,2,2-trifluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 135329154 |
| Molecular Formula | C7H4F6N2S2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 2,2,2-trifluoro-N-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]ethanethioamide |
| SMILES | FC(F)(F)C(=S)NCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C7H4F6N2S2/c8-6(9,10)4(16)14-1-3-2-15-5(17-3)7(11,12)13/h2H,1H2,(H,14,16) |
| InChIKey | WMBRBOKQENECBH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|