About 3-azidopropan-1-ol;diiminoazanium
3-azidopropan-1-ol;diiminoazanium (PubChem CID 135329156) has the molecular formula C3H9N6O+
and a molecular weight of 145.15 g/mol. Its IUPAC name is 3-azidopropan-1-ol;diiminoazanium.
Molecular Properties
| Compound Name | 3-azidopropan-1-ol;diiminoazanium |
| PubChem CID | 135329156 |
| Molecular Formula | C3H9N6O+ |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.08 |
| IUPAC Name | 3-azidopropan-1-ol;diiminoazanium |
| SMILES | N=[N+]=N.[N-]=[N+]=NCCCO |
| InChI | InChI=1S/C3H7N3O.H2N3/c4-6-5-2-1-3-7;1-3-2/h7H,1-3H2;1-2H/q;+1 |
| InChIKey | FQKKHXKMUNZIHZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azidopropan-1-ol;diiminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidopropan-1-ol;diiminoazanium?
The IUPAC name of 3-azidopropan-1-ol;diiminoazanium (CID 135329156) is 3-azidopropan-1-ol;diiminoazanium.
What is the SMILES notation for 3-azidopropan-1-ol;diiminoazanium?
The canonical SMILES for 3-azidopropan-1-ol;diiminoazanium is N=[N+]=N.[N-]=[N+]=NCCCO.
What is the InChIKey of 3-azidopropan-1-ol;diiminoazanium?
The InChIKey is FQKKHXKMUNZIHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O.H2N3/c4-6-5-2-1-3-7;1-3-2/h7H,1-3H2;1-2H/q;+1.
What are the key properties of 3-azidopropan-1-ol;diiminoazanium?
3-azidopropan-1-ol;diiminoazanium has a molecular weight of 145.15 g/mol, XLogP of 0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidopropan-1-ol;diiminoazanium is sourced from PubChem (CID 135329156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).