C26H25FN6 — CID 135329350
4-(4-aminopiperidin-1-yl)-3-(6-ethynyl-1H-benzimidazol-2-yl)-5-(3-fluoro-5-methylphenyl)pyridin-2-amine (PubChem CID 135329350) has the molecular formula C26H25FN6 and a molecular weight of 440.53 g/mol. Its IUPAC name is 4-(4-aminopiperidin-1-yl)-3-(6-ethynyl-1H-benzimidazol-2-yl)-5-(3-fluoro-5-methylphenyl)pyridin-2-amine.
| Compound Name | 4-(4-aminopiperidin-1-yl)-3-(6-ethynyl-1H-benzimidazol-2-yl)-5-(3-fluoro-5-methylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 135329350 |
| Molecular Formula | C26H25FN6 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-(4-aminopiperidin-1-yl)-3-(6-ethynyl-1H-benzimidazol-2-yl)-5-(3-fluoro-5-methylphenyl)pyridin-2-amine |
| SMILES | C#Cc1ccc2nc(-c3c(N)ncc(-c4cc(C)cc(F)c4)c3N3CCC(N)CC3)[nH]c2c1 |
| InChI | InChI=1S/C26H25FN6/c1-3-16-4-5-21-22(12-16)32-26(31-21)23-24(33-8-6-19(28)7-9-33)20(14-30-25(23)29)17-10-15(2)11-18(27)13-17/h1,4-5,10-14,19H,6-9,28H2,2H3,(H2,29,30)(H,31,32) |
| InChIKey | PTFAAUSTPOKMMP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|