C31H33ClN2O2 — CID 135329456
N-[6-(chloromethyl)isoquinolin-1-yl]-N-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]-3,3-dimethylbutanamide (PubChem CID 135329456) has the molecular formula C31H33ClN2O2 and a molecular weight of 501.07 g/mol. Its IUPAC name is N-[6-(chloromethyl)isoquinolin-1-yl]-N-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]-3,3-dimethylbutanamide.
| Compound Name | N-[6-(chloromethyl)isoquinolin-1-yl]-N-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 135329456 |
| Molecular Formula | C31H33ClN2O2 |
| Molecular Weight | 501.07 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | N-[6-(chloromethyl)isoquinolin-1-yl]-N-[[4-(4-methoxy-3-methylphenyl)phenyl]methyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(-c2ccc(CN(C(=O)CC(C)(C)C)c3nccc4cc(CCl)ccc34)cc2)cc1C |
| InChI | InChI=1S/C31H33ClN2O2/c1-21-16-25(11-13-28(21)36-5)24-9-6-22(7-10-24)20-34(29(35)18-31(2,3)4)30-27-12-8-23(19-32)17-26(27)14-15-33-30/h6-17H,18-20H2,1-5H3 |
| InChIKey | ZNGWVNPUVDTHDU-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.07 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|