C19H16N6O2S — CID 135329554
N-[3-[2-[(3-methyl-1,2-thiazol-5-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 135329554) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[3-[2-[(3-methyl-1,2-thiazol-5-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[(3-methyl-1,2-thiazol-5-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135329554 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[3-[2-[(3-methyl-1,2-thiazol-5-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3cc(C)ns3)nn3cccc23)c1 |
| InChI | InChI=1S/C19H16N6O2S/c1-3-16(26)20-13-6-4-7-14(11-13)27-18-15-8-5-9-25(15)23-19(22-18)21-17-10-12(2)24-28-17/h3-11H,1H2,2H3,(H,20,26)(H,21,23) |
| InChIKey | USUHNYHQNYCRBK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|