C20H17FN6O2 — CID 135329590
N-[4-fluoro-3-[2-[(1-methylpyrrol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 135329590) has the molecular formula C20H17FN6O2 and a molecular weight of 392.39 g/mol. Its IUPAC name is N-[4-fluoro-3-[2-[(1-methylpyrrol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[4-fluoro-3-[2-[(1-methylpyrrol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135329590 |
| Molecular Formula | C20H17FN6O2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[4-fluoro-3-[2-[(1-methylpyrrol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(Oc2nc(Nc3ccn(C)c3)nn3cccc23)c1 |
| InChI | InChI=1S/C20H17FN6O2/c1-3-18(28)22-13-6-7-15(21)17(11-13)29-19-16-5-4-9-27(16)25-20(24-19)23-14-8-10-26(2)12-14/h3-12H,1H2,2H3,(H,22,28)(H,23,25) |
| InChIKey | DEYGRFNJMKUPKQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|