C21H20FN7O2 — CID 135329623
N-[4-fluoro-3-[2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 135329623) has the molecular formula C21H20FN7O2 and a molecular weight of 421.44 g/mol. Its IUPAC name is N-[4-fluoro-3-[2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[4-fluoro-3-[2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135329623 |
| Molecular Formula | C21H20FN7O2 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[4-fluoro-3-[2-[(1-propan-2-ylpyrazol-4-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(Oc2nc(Nc3cnn(C(C)C)c3)nn3cccc23)c1 |
| InChI | InChI=1S/C21H20FN7O2/c1-4-19(30)24-14-7-8-16(22)18(10-14)31-20-17-6-5-9-28(17)27-21(26-20)25-15-11-23-29(12-15)13(2)3/h4-13H,1H2,2-3H3,(H,24,30)(H,25,27) |
| InChIKey | YXUPPZFNFDNYCC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|