About 3,4-dipentylthiazepine
3,4-dipentylthiazepine (PubChem CID 135330059) has the molecular formula C15H25NS
and a molecular weight of 251.44 g/mol. Its IUPAC name is 3,4-dipentylthiazepine.
Molecular Properties
| Compound Name | 3,4-dipentylthiazepine |
| PubChem CID | 135330059 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3,4-dipentylthiazepine |
| SMILES | CCCCCC1=CC=CSN=C1CCCCC |
| InChI | InChI=1S/C15H25NS/c1-3-5-7-10-14-11-9-13-17-16-15(14)12-8-6-4-2/h9,11,13H,3-8,10,12H2,1-2H3 |
| InChIKey | HTHHWWDQIRPDSB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dipentylthiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dipentylthiazepine?
The IUPAC name of 3,4-dipentylthiazepine (CID 135330059) is 3,4-dipentylthiazepine.
What is the SMILES notation for 3,4-dipentylthiazepine?
The canonical SMILES for 3,4-dipentylthiazepine is CCCCCC1=CC=CSN=C1CCCCC.
What is the InChIKey of 3,4-dipentylthiazepine?
The InChIKey is HTHHWWDQIRPDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NS/c1-3-5-7-10-14-11-9-13-17-16-15(14)12-8-6-4-2/h9,11,13H,3-8,10,12H2,1-2H3.
What are the key properties of 3,4-dipentylthiazepine?
3,4-dipentylthiazepine has a molecular weight of 251.44 g/mol, XLogP of 5.69, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dipentylthiazepine is sourced from PubChem (CID 135330059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).