C30H24F3N5O5 — CID 135330745
4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid (PubChem CID 135330745) has the molecular formula C30H24F3N5O5 and a molecular weight of 591.55 g/mol. Its IUPAC name is 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid.
| Compound Name | 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 135330745 |
| Molecular Formula | C30H24F3N5O5 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | 4-[[1-[3-[methyl-(2-methyl-[1,3]oxazolo[4,5-b]pyridin-6-yl)carbamoyl]phenyl]-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-7-yl]oxy]benzoic acid |
| SMILES | Cc1nc2ncc(N(C)C(=O)c3cccc(-n4nc(C(F)(F)F)c5c4C(Oc4ccc(C(=O)O)cc4)CCC5)c3)cc2o1 |
| InChI | InChI=1S/C30H24F3N5O5/c1-16-35-27-24(42-16)14-20(15-34-27)37(2)28(39)18-5-3-6-19(13-18)38-25-22(26(36-38)30(31,32)33)7-4-8-23(25)43-21-11-9-17(10-12-21)29(40)41/h3,5-6,9-15,23H,4,7-8H2,1-2H3,(H,40,41) |
| InChIKey | RMDIBERAOULVLD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |