About N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride
N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride (PubChem CID 135331183) has the molecular formula C5H9ClN2O2S2
and a molecular weight of 228.73 g/mol. Its IUPAC name is N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride |
| PubChem CID | 135331183 |
| Molecular Formula | C5H9ClN2O2S2 |
| Molecular Weight | 228.73 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride |
| SMILES | Cc1nc(NS(C)(=O)=O)cs1.Cl |
| InChI | InChI=1S/C5H8N2O2S2.ClH/c1-4-6-5(3-10-4)7-11(2,8)9;/h3,7H,1-2H3;1H |
| InChIKey | GHMYCOWVHAOUDI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.73 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride?
The IUPAC name of N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride (CID 135331183) is N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride.
What is the SMILES notation for N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride?
The canonical SMILES for N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride is Cc1nc(NS(C)(=O)=O)cs1.Cl.
What is the InChIKey of N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride?
The InChIKey is GHMYCOWVHAOUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2S2.ClH/c1-4-6-5(3-10-4)7-11(2,8)9;/h3,7H,1-2H3;1H.
What are the key properties of N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride?
N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride has a molecular weight of 228.73 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-1,3-thiazol-4-yl)methanesulfonamide;hydrochloride is sourced from PubChem (CID 135331183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).