C22H25N3O3 — CID 135331248
methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-pyridin-2-ylpropanoate (PubChem CID 135331248) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-pyridin-2-ylpropanoate.
| Compound Name | methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 135331248 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | methyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)-3-pyridin-2-ylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccn1)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C22H25N3O3/c1-28-21(26)19(13-16-8-2-3-11-23-16)24-22(27)25-20-17-9-4-6-14(17)12-15-7-5-10-18(15)20/h2-3,8,11-12,19H,4-7,9-10,13H2,1H3,(H2,24,25,27)/t19-/m1/s1 |
| InChIKey | SDFAQJCSXBFMOV-LJQANCHMSA-N |
| XLogP | 2.96 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |