C31H33N5O2 — CID 135331346
N-[3-[[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(4-methylimidazol-1-yl)phenyl]-4-methyl-3-phenoxybenzamide (PubChem CID 135331346) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[3-[[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(4-methylimidazol-1-yl)phenyl]-4-methyl-3-phenoxybenzamide.
| Compound Name | N-[3-[[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(4-methylimidazol-1-yl)phenyl]-4-methyl-3-phenoxybenzamide |
|---|---|
| PubChem CID | 135331346 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N-[3-[[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]methyl]-5-(4-methylimidazol-1-yl)phenyl]-4-methyl-3-phenoxybenzamide |
| SMILES | Cc1cn(-c2cc(CN3C[C@@H]4CCN[C@@H]4C3)cc(NC(=O)c3ccc(C)c(Oc4ccccc4)c3)c2)cn1 |
| InChI | InChI=1S/C31H33N5O2/c1-21-8-9-24(14-30(21)38-28-6-4-3-5-7-28)31(37)34-26-12-23(13-27(15-26)36-16-22(2)33-20-36)17-35-18-25-10-11-32-29(25)19-35/h3-9,12-16,20,25,29,32H,10-11,17-19H2,1-2H3,(H,34,37)/t25-,29+/m0/s1 |
| InChIKey | YDWBRJZRDCPWRG-ABYGYWHVSA-N |
| XLogP | 5.33 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |