C20H35BrO3 — CID 135331976
(7E,11E)-4-bromo-3,7-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-3-ol (PubChem CID 135331976) has the molecular formula C20H35BrO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is (7E,11E)-4-bromo-3,7-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-3-ol.
| Compound Name | (7E,11E)-4-bromo-3,7-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-3-ol |
|---|---|
| PubChem CID | 135331976 |
| Molecular Formula | C20H35BrO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (7E,11E)-4-bromo-3,7-dimethyl-13-(oxan-2-yloxy)trideca-7,11-dien-3-ol |
| SMILES | CCC(C)(O)C(Br)CC/C(C)=C/CC/C=C/COC1CCCCO1 |
| InChI | InChI=1S/C20H35BrO3/c1-4-20(3,22)18(21)14-13-17(2)11-7-5-6-9-15-23-19-12-8-10-16-24-19/h6,9,11,18-19,22H,4-5,7-8,10,12-16H2,1-3H3/b9-6+,17-11+ |
| InChIKey | GLRVGWBEQMBAMW-OEMBIGBOSA-N |
| XLogP | 5.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|