C16H17F3N2O2 — CID 135332162
3-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-5-(trifluoromethyl)benzaldehyde (PubChem CID 135332162) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 3-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-5-(trifluoromethyl)benzaldehyde.
| Compound Name | 3-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-5-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 135332162 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-(5-acetyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-5-(trifluoromethyl)benzaldehyde |
| SMILES | CC(=O)N1CC2CN(c3cc(C=O)cc(C(F)(F)F)c3)CC2C1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-10(23)20-5-12-7-21(8-13(12)6-20)15-3-11(9-22)2-14(4-15)16(17,18)19/h2-4,9,12-13H,5-8H2,1H3 |
| InChIKey | AHDRFTNABKWISY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|