C22H18Cl2N4O2 — CID 135332552
1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one (PubChem CID 135332552) has the molecular formula C22H18Cl2N4O2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 135332552 |
| Molecular Formula | C22H18Cl2N4O2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-4-[5-(3-hydroxyazetidin-1-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyridin-2-one |
| SMILES | O=c1cc(-c2c[nH]c3ncc(N4CC(O)C4)cc23)ccn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N4O2/c23-19-2-1-13(5-20(19)24)10-27-4-3-14(6-21(27)30)18-9-26-22-17(18)7-15(8-25-22)28-11-16(29)12-28/h1-9,16,29H,10-12H2,(H,25,26) |
| InChIKey | IKJPPRQWVCFUCS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|