About 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine
3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine (PubChem CID 135332651) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine.
Molecular Properties
| Compound Name | 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine |
| PubChem CID | 135332651 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine |
| SMILES | CC1NCCOC1c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C12H15N3O/c1-8-11(16-5-4-13-8)10-6-9-2-3-14-12(9)15-7-10/h2-3,6-8,11,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | LWZWHBOYPDTGFH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine?
The IUPAC name of 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine (CID 135332651) is 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine.
What is the SMILES notation for 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine?
The canonical SMILES for 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine is CC1NCCOC1c1cnc2[nH]ccc2c1.
What is the InChIKey of 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine?
The InChIKey is LWZWHBOYPDTGFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-8-11(16-5-4-13-8)10-6-9-2-3-14-12(9)15-7-10/h2-3,6-8,11,13H,4-5H2,1H3,(H,14,15).
What are the key properties of 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine?
3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine has a molecular weight of 217.27 g/mol, XLogP of 1.61, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)morpholine is sourced from PubChem (CID 135332651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).