About N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine
N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine (PubChem CID 135333224) has the molecular formula C25H24FN5
and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine |
| PubChem CID | 135333224 |
| Molecular Formula | C25H24FN5 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(F)cc2c1cc(C)n2CCNc1cc(-c2ccc3c(ccn3C)c2)ncn1 |
| InChI | InChI=1S/C25H24FN5/c1-16-10-20(26)13-24-21(16)11-17(2)31(24)9-7-27-25-14-22(28-15-29-25)18-4-5-23-19(12-18)6-8-30(23)3/h4-6,8,10-15H,7,9H2,1-3H3,(H,27,28,29) |
| InChIKey | SDEDLOVGRTYEFD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine?
The IUPAC name of N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine (CID 135333224) is N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine.
What is the SMILES notation for N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine?
The canonical SMILES for N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine is Cc1cc(F)cc2c1cc(C)n2CCNc1cc(-c2ccc3c(ccn3C)c2)ncn1.
What is the InChIKey of N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine?
The InChIKey is SDEDLOVGRTYEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24FN5/c1-16-10-20(26)13-24-21(16)11-17(2)31(24)9-7-27-25-14-22(28-15-29-25)18-4-5-23-19(12-18)6-8-30(23)3/h4-6,8,10-15H,7,9H2,1-3H3,(H,27,28,29).
What are the key properties of N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine?
N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine has a molecular weight of 413.50 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(6-fluoro-2,4-dimethylindol-1-yl)ethyl]-6-(1-methylindol-5-yl)pyrimidin-4-amine is sourced from PubChem (CID 135333224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).