C26H25N5O2 — CID 135333561
4-[6-[2-(2-cyanoindol-1-yl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropyl)benzoic acid (PubChem CID 135333561) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-[6-[2-(2-cyanoindol-1-yl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropyl)benzoic acid.
| Compound Name | 4-[6-[2-(2-cyanoindol-1-yl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropyl)benzoic acid |
|---|---|
| PubChem CID | 135333561 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-[6-[2-(2-cyanoindol-1-yl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropyl)benzoic acid |
| SMILES | CC(C)Cc1cc(-c2cc(NCCn3c(C#N)cc4ccccc43)ncn2)ccc1C(=O)O |
| InChI | InChI=1S/C26H25N5O2/c1-17(2)11-20-12-18(7-8-22(20)26(32)33)23-14-25(30-16-29-23)28-9-10-31-21(15-27)13-19-5-3-4-6-24(19)31/h3-8,12-14,16-17H,9-11H2,1-2H3,(H,32,33)(H,28,29,30) |
| InChIKey | PJVLYKJMLPVRNN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |