C16H16Cl2FN3O — CID 135333576
6-chloro-1-[2-(6-chloro-2H-pyrimidin-1-yl)ethyl]-7-fluoro-4-methoxy-2-methylindole (PubChem CID 135333576) has the molecular formula C16H16Cl2FN3O and a molecular weight of 356.23 g/mol. Its IUPAC name is 6-chloro-1-[2-(6-chloro-2H-pyrimidin-1-yl)ethyl]-7-fluoro-4-methoxy-2-methylindole.
| Compound Name | 6-chloro-1-[2-(6-chloro-2H-pyrimidin-1-yl)ethyl]-7-fluoro-4-methoxy-2-methylindole |
|---|---|
| PubChem CID | 135333576 |
| Molecular Formula | C16H16Cl2FN3O |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 6-chloro-1-[2-(6-chloro-2H-pyrimidin-1-yl)ethyl]-7-fluoro-4-methoxy-2-methylindole |
| SMILES | COc1cc(Cl)c(F)c2c1cc(C)n2CCN1CN=CC=C1Cl |
| InChI | InChI=1S/C16H16Cl2FN3O/c1-10-7-11-13(23-2)8-12(17)15(19)16(11)22(10)6-5-21-9-20-4-3-14(21)18/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | MEWFRNHJDBOMOZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|