C16H13N5O4S — CID 135333988
ethyl 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylate (PubChem CID 135333988) has the molecular formula C16H13N5O4S and a molecular weight of 371.38 g/mol. Its IUPAC name is ethyl 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylate.
| Compound Name | ethyl 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 135333988 |
| Molecular Formula | C16H13N5O4S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | ethyl 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2c(N3CCc4cc([N+](=O)[O-])ccc43)ncnc2s1 |
| InChI | InChI=1S/C16H13N5O4S/c1-2-25-16(22)15-19-12-13(17-8-18-14(12)26-15)20-6-5-9-7-10(21(23)24)3-4-11(9)20/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | TWMZCRJRAHKAFM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 111.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|