C19H22N6OS — CID 135334241
7-(2,3-dihydroindol-1-yl)-N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide (PubChem CID 135334241) has the molecular formula C19H22N6OS and a molecular weight of 382.49 g/mol. Its IUPAC name is 7-(2,3-dihydroindol-1-yl)-N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide.
| Compound Name | 7-(2,3-dihydroindol-1-yl)-N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 135334241 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 7-(2,3-dihydroindol-1-yl)-N-[3-(dimethylamino)propyl]-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1nc2c(N3CCc4ccccc43)ncnc2s1 |
| InChI | InChI=1S/C19H22N6OS/c1-24(2)10-5-9-20-17(26)19-23-15-16(21-12-22-18(15)27-19)25-11-8-13-6-3-4-7-14(13)25/h3-4,6-7,12H,5,8-11H2,1-2H3,(H,20,26) |
| InChIKey | CXNIDEGZWPEOCF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|