C27H33N7O3S — CID 135334323
3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridin-6-yl]-2-(2-methyl-4-pyridinyl)-2H-1,3-oxazole-4-carboxamide (PubChem CID 135334323) has the molecular formula C27H33N7O3S and a molecular weight of 535.67 g/mol. Its IUPAC name is 3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridin-6-yl]-2-(2-methyl-4-pyridinyl)-2H-1,3-oxazole-4-carboxamide.
| Compound Name | 3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridin-6-yl]-2-(2-methyl-4-pyridinyl)-2H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 135334323 |
| Molecular Formula | C27H33N7O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-piperidin-1-yl-[1,3]thiazolo[4,5-b]pyridin-6-yl]-2-(2-methyl-4-pyridinyl)-2H-1,3-oxazole-4-carboxamide |
| SMILES | Cc1cc(C2OC=C(C(N)=O)N2c2cc3sc(N4C[C@@H](C)O[C@@H](C)C4)nc3nc2N2CCCCC2)ccn1 |
| InChI | InChI=1S/C27H33N7O3S/c1-16-11-19(7-8-29-16)26-34(21(15-36-26)23(28)35)20-12-22-24(30-25(20)32-9-5-4-6-10-32)31-27(38-22)33-13-17(2)37-18(3)14-33/h7-8,11-12,15,17-18,26H,4-6,9-10,13-14H2,1-3H3,(H2,28,35)/t17-,18+,26? |
| InChIKey | UMVNJNRDNLELND-PQJFKPCWSA-N |
| XLogP | 3.86 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |