About 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde
5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde (PubChem CID 135334437) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde |
| PubChem CID | 135334437 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde |
| SMILES | O=Cc1cnn2c1-c1ccccc1OC2 |
| InChI | InChI=1S/C11H8N2O2/c14-6-8-5-12-13-7-15-10-4-2-1-3-9(10)11(8)13/h1-6H,7H2 |
| InChIKey | RBDSNEGHNPNINJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde?
The IUPAC name of 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde (CID 135334437) is 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde.
What is the SMILES notation for 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde?
The canonical SMILES for 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde is O=Cc1cnn2c1-c1ccccc1OC2.
What is the InChIKey of 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde?
The InChIKey is RBDSNEGHNPNINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c14-6-8-5-12-13-7-15-10-4-2-1-3-9(10)11(8)13/h1-6H,7H2.
What are the key properties of 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde?
5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde has a molecular weight of 200.20 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrazolo[1,5-c][1,3]benzoxazine-1-carbaldehyde is sourced from PubChem (CID 135334437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).