C12H10ClNO3 — CID 135334733
2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid (PubChem CID 135334733) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid.
| Compound Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 135334733 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C12H10ClNO3/c1-7(12(15)16)10-6-11(17-14-10)8-2-4-9(13)5-3-8/h2-7H,1H3,(H,15,16) |
| InChIKey | DRIABKOMPJLWHP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |