2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid

C12H10ClNO3 — CID 135334733

IUPAC2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid
SMILESCC(C(=O)O)c1cc(-c2ccc(Cl)cc2)on1
InChIInChI=1S/C12H10ClNO3/c1-7(12(15)16)10-6-11(17-14-10)8-2-4-9(13)5-3-8/h2-7H,1H3,(H,15,16)
InChIKeyDRIABKOMPJLWHP-UHFFFAOYSA-N
MW251.67 g/mol
LogP3.18
Rot. Bonds3

About 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid

2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid (PubChem CID 135334733) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid.

Molecular Properties

Compound Name2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid
PubChem CID135334733
Molecular FormulaC12H10ClNO3
Molecular Weight251.67 g/mol
Exact Mass251.03
IUPAC Name2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid
SMILESCC(C(=O)O)c1cc(-c2ccc(Cl)cc2)on1
InChIInChI=1S/C12H10ClNO3/c1-7(12(15)16)10-6-11(17-14-10)8-2-4-9(13)5-3-8/h2-7H,1H3,(H,15,16)
InChIKeyDRIABKOMPJLWHP-UHFFFAOYSA-N
XLogP3.18
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.67
LogP ≤ 53.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
The IUPAC name of 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid (CID 135334733) is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid.
What is the SMILES notation for 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
The canonical SMILES for 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid is CC(C(=O)O)c1cc(-c2ccc(Cl)cc2)on1.
What is the InChIKey of 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
The InChIKey is DRIABKOMPJLWHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO3/c1-7(12(15)16)10-6-11(17-14-10)8-2-4-9(13)5-3-8/h2-7H,1H3,(H,15,16).
What are the key properties of 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid?
2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid has a molecular weight of 251.67 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]propanoic acid is sourced from PubChem (CID 135334733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).