C19H21ClN4O3 — CID 135335172
N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl]acetamide (PubChem CID 135335172) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 135335172 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]amino]ethyl]acetamide |
| SMILES | COc1cc(OC)c(-c2cn3ccc(NCCNC(C)=O)cc3n2)cc1Cl |
| InChI | InChI=1S/C19H21ClN4O3/c1-12(25)21-5-6-22-13-4-7-24-11-16(23-19(24)8-13)14-9-15(20)18(27-3)10-17(14)26-2/h4,7-11,22H,5-6H2,1-3H3,(H,21,25) |
| InChIKey | MKXGBNSOSGQYHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|