C23H30ClN5O2 — CID 135335283
3-[4-chloro-5-methoxy-2-(7-piperazin-1-ylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 135335283) has the molecular formula C23H30ClN5O2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 3-[4-chloro-5-methoxy-2-(7-piperazin-1-ylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-chloro-5-methoxy-2-(7-piperazin-1-ylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 135335283 |
| Molecular Formula | C23H30ClN5O2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 3-[4-chloro-5-methoxy-2-(7-piperazin-1-ylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1cc(OCCCN(C)C)c(-c2cn3ccc(N4CCNCC4)cc3n2)cc1Cl |
| InChI | InChI=1S/C23H30ClN5O2/c1-27(2)8-4-12-31-21-15-22(30-3)19(24)14-18(21)20-16-29-9-5-17(13-23(29)26-20)28-10-6-25-7-11-28/h5,9,13-16,25H,4,6-8,10-12H2,1-3H3 |
| InChIKey | KJLJDSHBXJRADR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|