C23H28ClN5O4 — CID 135335292
N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl]amino]ethyl]acetamide (PubChem CID 135335292) has the molecular formula C23H28ClN5O4 and a molecular weight of 473.96 g/mol. Its IUPAC name is N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 135335292 |
| Molecular Formula | C23H28ClN5O4 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[2-[[2-(5-chloro-2,4-dimethoxyphenyl)-7-morpholin-4-ylimidazo[1,2-a]pyridin-6-yl]amino]ethyl]acetamide |
| SMILES | COc1cc(OC)c(-c2cn3cc(NCCNC(C)=O)c(N4CCOCC4)cc3n2)cc1Cl |
| InChI | InChI=1S/C23H28ClN5O4/c1-15(30)25-4-5-26-19-14-29-13-18(16-10-17(24)22(32-3)12-21(16)31-2)27-23(29)11-20(19)28-6-8-33-9-7-28/h10-14,26H,4-9H2,1-3H3,(H,25,30) |
| InChIKey | OIWTVPDUCJWHEJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|