About 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine
6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine (PubChem CID 135335358) has the molecular formula C16H14BrClN2O3
and a molecular weight of 397.66 g/mol. Its IUPAC name is 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine |
| PubChem CID | 135335358 |
| Molecular Formula | C16H14BrClN2O3 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine |
| SMILES | COc1cc(OC)c(-c2cn3cc(Br)c(OC)cc3n2)cc1Cl |
| InChI | InChI=1S/C16H14BrClN2O3/c1-21-13-5-15(23-3)11(18)4-9(13)12-8-20-7-10(17)14(22-2)6-16(20)19-12/h4-8H,1-3H3 |
| InChIKey | JNLHUFHYGJDBEU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine?
The IUPAC name of 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine (CID 135335358) is 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine?
The canonical SMILES for 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine is COc1cc(OC)c(-c2cn3cc(Br)c(OC)cc3n2)cc1Cl.
What is the InChIKey of 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine?
The InChIKey is JNLHUFHYGJDBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrClN2O3/c1-21-13-5-15(23-3)11(18)4-9(13)12-8-20-7-10(17)14(22-2)6-16(20)19-12/h4-8H,1-3H3.
What are the key properties of 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine?
6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine has a molecular weight of 397.66 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(5-chloro-2,4-dimethoxyphenyl)-7-methoxyimidazo[1,2-a]pyridine is sourced from PubChem (CID 135335358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).