C21H22ClIN4O4 — CID 135335365
[1-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-2-iodopiperidin-4-yl]carbamic acid (PubChem CID 135335365) has the molecular formula C21H22ClIN4O4 and a molecular weight of 556.79 g/mol. Its IUPAC name is [1-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-2-iodopiperidin-4-yl]carbamic acid.
| Compound Name | [1-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-2-iodopiperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 135335365 |
| Molecular Formula | C21H22ClIN4O4 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | [1-[2-(5-chloro-2,4-dimethoxyphenyl)imidazo[1,2-a]pyridin-7-yl]-2-iodopiperidin-4-yl]carbamic acid |
| SMILES | COc1cc(OC)c(-c2cn3ccc(N4CCC(NC(=O)O)CC4I)cc3n2)cc1Cl |
| InChI | InChI=1S/C21H22ClIN4O4/c1-30-17-10-18(31-2)15(22)9-14(17)16-11-26-5-4-13(8-20(26)25-16)27-6-3-12(7-19(27)23)24-21(28)29/h4-5,8-12,19,24H,3,6-7H2,1-2H3,(H,28,29) |
| InChIKey | MPAOVVORZIHTBC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|