About 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine
2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine (PubChem CID 135335373) has the molecular formula C16H16ClN3O2
and a molecular weight of 317.78 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine |
| PubChem CID | 135335373 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine |
| SMILES | CNc1ccn2cc(-c3cc(Cl)c(OC)cc3OC)nc2c1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-18-10-4-5-20-9-13(19-16(20)6-10)11-7-12(17)15(22-3)8-14(11)21-2/h4-9,18H,1-3H3 |
| InChIKey | ATWHEVKPFPHNIT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine?
The IUPAC name of 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine (CID 135335373) is 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine.
What is the SMILES notation for 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine?
The canonical SMILES for 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine is CNc1ccn2cc(-c3cc(Cl)c(OC)cc3OC)nc2c1.
What is the InChIKey of 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine?
The InChIKey is ATWHEVKPFPHNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O2/c1-18-10-4-5-20-9-13(19-16(20)6-10)11-7-12(17)15(22-3)8-14(11)21-2/h4-9,18H,1-3H3.
What are the key properties of 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine?
2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine has a molecular weight of 317.78 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2,4-dimethoxyphenyl)-N-methylimidazo[1,2-a]pyridin-7-amine is sourced from PubChem (CID 135335373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).