C28H25FN4O3 — CID 135337491
1-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one (PubChem CID 135337491) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is 1-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 135337491 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-[(2S)-2-[1-[4-(2-fluoro-3-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCC[C@H]1c1nc(-c2ccc(Oc3cccc(OC)c3F)cc2)c2cnccn12 |
| InChI | InChI=1S/C28H25FN4O3/c1-3-7-25(34)32-16-5-4-8-21(32)28-31-27(22-18-30-15-17-33(22)28)19-11-13-20(14-12-19)36-24-10-6-9-23(35-2)26(24)29/h6,9-15,17-18,21H,4-5,8,16H2,1-2H3/t21-/m0/s1 |
| InChIKey | PHPMJHNKOPXOJB-NRFANRHFSA-N |
| XLogP | 5.41 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|