C27H26N6O3 — CID 135337547
4-[5-ethoxy-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 135337547) has the molecular formula C27H26N6O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is 4-[5-ethoxy-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[5-ethoxy-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 135337547 |
| Molecular Formula | C27H26N6O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 4-[5-ethoxy-3-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1CC[C@@H](c2nc(-c3ccc(C(=O)Nc4ccccn4)cc3)c3cncc(OCC)n23)C1 |
| InChI | InChI=1S/C27H26N6O3/c1-3-23(34)32-14-12-20(17-32)26-31-25(21-15-28-16-24(33(21)26)36-4-2)18-8-10-19(11-9-18)27(35)30-22-7-5-6-13-29-22/h3,5-11,13,15-16,20H,1,4,12,14,17H2,2H3,(H,29,30,35)/t20-/m1/s1 |
| InChIKey | POHPCHVWUSCUTQ-HXUWFJFHSA-N |
| XLogP | 3.94 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|