C26H22F2N4O2 — CID 135337556
1-[(2S)-2-[1-[4-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 135337556) has the molecular formula C26H22F2N4O2 and a molecular weight of 460.48 g/mol. Its IUPAC name is 1-[(2S)-2-[1-[4-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S)-2-[1-[4-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135337556 |
| Molecular Formula | C26H22F2N4O2 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 1-[(2S)-2-[1-[4-[(2,6-difluorophenyl)methoxy]phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H]1c1nc(-c2ccc(OCc3c(F)cccc3F)cc2)c2cnccn12 |
| InChI | InChI=1S/C26H22F2N4O2/c1-2-24(33)31-13-4-7-22(31)26-30-25(23-15-29-12-14-32(23)26)17-8-10-18(11-9-17)34-16-19-20(27)5-3-6-21(19)28/h2-3,5-6,8-12,14-15,22H,1,4,7,13,16H2/t22-/m0/s1 |
| InChIKey | CZXXHLKIPJUICC-QFIPXVFZSA-N |
| XLogP | 5.10 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|