C28H24F2N4O2 — CID 135337728
1-[(2S)-2-[1-[4-(2,3-difluorophenoxy)phenyl]-8-methylimidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one (PubChem CID 135337728) has the molecular formula C28H24F2N4O2 and a molecular weight of 486.52 g/mol. Its IUPAC name is 1-[(2S)-2-[1-[4-(2,3-difluorophenoxy)phenyl]-8-methylimidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(2S)-2-[1-[4-(2,3-difluorophenoxy)phenyl]-8-methylimidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 135337728 |
| Molecular Formula | C28H24F2N4O2 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-[(2S)-2-[1-[4-(2,3-difluorophenoxy)phenyl]-8-methylimidazo[1,5-a]pyrazin-3-yl]piperidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCCC[C@H]1c1nc(-c2ccc(Oc3cccc(F)c3F)cc2)c2c(C)nccn12 |
| InChI | InChI=1S/C28H24F2N4O2/c1-3-7-24(35)33-16-5-4-9-22(33)28-32-26(27-18(2)31-15-17-34(27)28)19-11-13-20(14-12-19)36-23-10-6-8-21(29)25(23)30/h6,8,10-15,17,22H,4-5,9,16H2,1-2H3/t22-/m0/s1 |
| InChIKey | CZTATRSYRGQCSC-QFIPXVFZSA-N |
| XLogP | 5.85 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|