C23H31N3O2 — CID 135337873
4-[(3aR)-2-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzonitrile (PubChem CID 135337873) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[(3aR)-2-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzonitrile.
| Compound Name | 4-[(3aR)-2-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 135337873 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 4-[(3aR)-2-[2-(4,4-diethyl-5-oxooxolan-2-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzonitrile |
| SMILES | CCC1(CC)CC(CCN2CC3CN(c4ccc(C#N)cc4)C[C@H]3C2)OC1=O |
| InChI | InChI=1S/C23H31N3O2/c1-3-23(4-2)11-21(28-22(23)27)9-10-25-13-18-15-26(16-19(18)14-25)20-7-5-17(12-24)6-8-20/h5-8,18-19,21H,3-4,9-11,13-16H2,1-2H3/t18-,19?,21?/m1/s1 |
| InChIKey | SOQOMBOGEGWYTJ-LWEYNCJUSA-N |
| XLogP | 3.44 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |