C21H31N3O2 — CID 135337909
3,3-diethyl-5-[2-(5-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)ethyl]oxolan-2-one (PubChem CID 135337909) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3,3-diethyl-5-[2-(5-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)ethyl]oxolan-2-one.
| Compound Name | 3,3-diethyl-5-[2-(5-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 135337909 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 3,3-diethyl-5-[2-(5-pyridin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)ethyl]oxolan-2-one |
| SMILES | CCC1(CC)CC(CCN2CC3CN(c4ccncc4)CC3C2)OC1=O |
| InChI | InChI=1S/C21H31N3O2/c1-3-21(4-2)11-19(26-20(21)25)7-10-23-12-16-14-24(15-17(16)13-23)18-5-8-22-9-6-18/h5-6,8-9,16-17,19H,3-4,7,10-15H2,1-2H3 |
| InChIKey | ZBYNZFFKXHJLQX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |