C26H39N3O3 — CID 135337943
3,3-diethyl-5-[2-[5-(2-morpholin-4-ylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]oxolan-2-one (PubChem CID 135337943) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 3,3-diethyl-5-[2-[5-(2-morpholin-4-ylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]oxolan-2-one.
| Compound Name | 3,3-diethyl-5-[2-[5-(2-morpholin-4-ylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 135337943 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 3,3-diethyl-5-[2-[5-(2-morpholin-4-ylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]oxolan-2-one |
| SMILES | CCC1(CC)CC(CCN2CC3CN(c4ccccc4N4CCOCC4)CC3C2)OC1=O |
| InChI | InChI=1S/C26H39N3O3/c1-3-26(4-2)15-22(32-25(26)30)9-10-27-16-20-18-29(19-21(20)17-27)24-8-6-5-7-23(24)28-11-13-31-14-12-28/h5-8,20-22H,3-4,9-19H2,1-2H3 |
| InChIKey | ADIKNEHLEGRBEL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |