C23H33N3O2 — CID 135338017
3-[2-[5-(3-methyl-4-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-2-oxaspiro[4.5]decan-1-one (PubChem CID 135338017) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 3-[2-[5-(3-methyl-4-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-2-oxaspiro[4.5]decan-1-one.
| Compound Name | 3-[2-[5-(3-methyl-4-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-2-oxaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 135338017 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 3-[2-[5-(3-methyl-4-pyridinyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-2-oxaspiro[4.5]decan-1-one |
| SMILES | Cc1cnccc1N1CC2CN(CCC3CC4(CCCCC4)C(=O)O3)CC2C1 |
| InChI | InChI=1S/C23H33N3O2/c1-17-12-24-9-5-21(17)26-15-18-13-25(14-19(18)16-26)10-6-20-11-23(22(27)28-20)7-3-2-4-8-23/h5,9,12,18-20H,2-4,6-8,10-11,13-16H2,1H3 |
| InChIKey | HVGOSLKNDABISN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |