C28H50N4O17 — CID 135338046
6-[[2-[bis[2-oxo-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]ethyl]amino]acetyl]amino]hexanoic acid (PubChem CID 135338046) has the molecular formula C28H50N4O17 and a molecular weight of 714.72 g/mol. Its IUPAC name is 6-[[2-[bis[2-oxo-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]ethyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[bis[2-oxo-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]ethyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 135338046 |
| Molecular Formula | C28H50N4O17 |
| Molecular Weight | 714.72 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | 6-[[2-[bis[2-oxo-2-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylamino]ethyl]amino]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CN(CC(=O)NCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC(=O)NCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H50N4O17/c33-13-15-21(40)23(42)25(44)27(48-15)46-8-6-30-18(36)11-32(10-17(35)29-5-3-1-2-4-20(38)39)12-19(37)31-7-9-47-28-26(45)24(43)22(41)16(14-34)49-28/h15-16,21-28,33-34,40-45H,1-14H2,(H,29,35)(H,30,36)(H,31,37)(H,38,39)/t15-,16-,21-,22-,23+,24+,25-,26-,27+,28+/m1/s1 |
| InChIKey | LZRGEUACCQLZET-VCCZMRIQSA-N |
| XLogP | -7.09 |
| TPSA | 326.60 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.72 |
| LogP ≤ 5 | -7.09 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|