4-(methyldisulfanyl)pyridine-3-carboxylic acid

C7H7NO2S2 — CID 135338592

IUPAC4-(methyldisulfanyl)pyridine-3-carboxylic acid
SMILESCSSc1ccncc1C(=O)O
InChIInChI=1S/C7H7NO2S2/c1-11-12-6-2-3-8-4-5(6)7(9)10/h2-4H,1H3,(H,9,10)
InChIKeyBQTHAIKVTHMYOX-UHFFFAOYSA-N
MW201.27 g/mol
LogP2.15
Rot. Bonds3

About 4-(methyldisulfanyl)pyridine-3-carboxylic acid

4-(methyldisulfanyl)pyridine-3-carboxylic acid (PubChem CID 135338592) has the molecular formula C7H7NO2S2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(methyldisulfanyl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-(methyldisulfanyl)pyridine-3-carboxylic acid
PubChem CID135338592
Molecular FormulaC7H7NO2S2
Molecular Weight201.27 g/mol
Exact Mass200.99
IUPAC Name4-(methyldisulfanyl)pyridine-3-carboxylic acid
SMILESCSSc1ccncc1C(=O)O
InChIInChI=1S/C7H7NO2S2/c1-11-12-6-2-3-8-4-5(6)7(9)10/h2-4H,1H3,(H,9,10)
InChIKeyBQTHAIKVTHMYOX-UHFFFAOYSA-N
XLogP2.15
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'disulphide', 'substructure': 'N/A'}

Analyze 4-(methyldisulfanyl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(methyldisulfanyl)pyridine-3-carboxylic acid?
The IUPAC name of 4-(methyldisulfanyl)pyridine-3-carboxylic acid (CID 135338592) is 4-(methyldisulfanyl)pyridine-3-carboxylic acid.
What is the SMILES notation for 4-(methyldisulfanyl)pyridine-3-carboxylic acid?
The canonical SMILES for 4-(methyldisulfanyl)pyridine-3-carboxylic acid is CSSc1ccncc1C(=O)O.
What is the InChIKey of 4-(methyldisulfanyl)pyridine-3-carboxylic acid?
The InChIKey is BQTHAIKVTHMYOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2S2/c1-11-12-6-2-3-8-4-5(6)7(9)10/h2-4H,1H3,(H,9,10).
What are the key properties of 4-(methyldisulfanyl)pyridine-3-carboxylic acid?
4-(methyldisulfanyl)pyridine-3-carboxylic acid has a molecular weight of 201.27 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methyldisulfanyl)pyridine-3-carboxylic acid is sourced from PubChem (CID 135338592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).