About spiro[indene-2,4'-piperidine]-4-ol
spiro[indene-2,4'-piperidine]-4-ol (PubChem CID 135338910) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is spiro[indene-2,4'-piperidine]-4-ol.
Molecular Properties
| Compound Name | spiro[indene-2,4'-piperidine]-4-ol |
| PubChem CID | 135338910 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | spiro[indene-2,4'-piperidine]-4-ol |
| SMILES | Oc1cccc2c1=CC1(C=2)CCNCC1 |
| InChI | InChI=1S/C13H15NO/c15-12-3-1-2-10-8-13(9-11(10)12)4-6-14-7-5-13/h1-3,8-9,14-15H,4-7H2 |
| InChIKey | RBWPJFAVSKSSKX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[indene-2,4'-piperidine]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[indene-2,4'-piperidine]-4-ol?
The IUPAC name of spiro[indene-2,4'-piperidine]-4-ol (CID 135338910) is spiro[indene-2,4'-piperidine]-4-ol.
What is the SMILES notation for spiro[indene-2,4'-piperidine]-4-ol?
The canonical SMILES for spiro[indene-2,4'-piperidine]-4-ol is Oc1cccc2c1=CC1(C=2)CCNCC1.
What is the InChIKey of spiro[indene-2,4'-piperidine]-4-ol?
The InChIKey is RBWPJFAVSKSSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c15-12-3-1-2-10-8-13(9-11(10)12)4-6-14-7-5-13/h1-3,8-9,14-15H,4-7H2.
What are the key properties of spiro[indene-2,4'-piperidine]-4-ol?
spiro[indene-2,4'-piperidine]-4-ol has a molecular weight of 201.27 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[indene-2,4'-piperidine]-4-ol is sourced from PubChem (CID 135338910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).