About spiro[indene-2,4'-piperidine]-1-amine
spiro[indene-2,4'-piperidine]-1-amine (PubChem CID 135338919) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is spiro[indene-2,4'-piperidine]-1-amine.
Molecular Properties
| Compound Name | spiro[indene-2,4'-piperidine]-1-amine |
| PubChem CID | 135338919 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | spiro[indene-2,4'-piperidine]-1-amine |
| SMILES | NC1=c2ccccc2=CC12CCNCC2 |
| InChI | InChI=1S/C13H16N2/c14-12-11-4-2-1-3-10(11)9-13(12)5-7-15-8-6-13/h1-4,9,15H,5-8,14H2 |
| InChIKey | NBQPTFOFZGZJRN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[indene-2,4'-piperidine]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[indene-2,4'-piperidine]-1-amine?
The IUPAC name of spiro[indene-2,4'-piperidine]-1-amine (CID 135338919) is spiro[indene-2,4'-piperidine]-1-amine.
What is the SMILES notation for spiro[indene-2,4'-piperidine]-1-amine?
The canonical SMILES for spiro[indene-2,4'-piperidine]-1-amine is NC1=c2ccccc2=CC12CCNCC2.
What is the InChIKey of spiro[indene-2,4'-piperidine]-1-amine?
The InChIKey is NBQPTFOFZGZJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c14-12-11-4-2-1-3-10(11)9-13(12)5-7-15-8-6-13/h1-4,9,15H,5-8,14H2.
What are the key properties of spiro[indene-2,4'-piperidine]-1-amine?
spiro[indene-2,4'-piperidine]-1-amine has a molecular weight of 200.28 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[indene-2,4'-piperidine]-1-amine is sourced from PubChem (CID 135338919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).