About 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid
4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 135339901) has the molecular formula C18H26N2O5
and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 135339901 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H26N2O5/c21-15(19-12-13-5-7-14(8-6-13)18(24)25)4-2-1-3-11-20-16(22)9-10-17(20)23/h9-10,13-14H,1-8,11-12H2,(H,19,21)(H,24,25) |
| InChIKey | HCMIHWOGHFABTM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid (CID 135339901) is 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid is O=C(CCCCCN1C(=O)C=CC1=O)NCC1CCC(C(=O)O)CC1.
What is the InChIKey of 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid?
The InChIKey is HCMIHWOGHFABTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O5/c21-15(19-12-13-5-7-14(8-6-13)18(24)25)4-2-1-3-11-20-16(22)9-10-17(20)23/h9-10,13-14H,1-8,11-12H2,(H,19,21)(H,24,25).
What are the key properties of 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid?
4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid has a molecular weight of 350.42 g/mol, XLogP of 1.48, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 135339901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).