C18H17N3O5 — CID 135340199
(Z)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoic acid (PubChem CID 135340199) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is (Z)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135340199 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (Z)-3-[4-(2,6-dimethoxyphenyl)-5-(5-methylfuran-2-yl)-1,2,4-triazol-3-yl]prop-2-enoic acid |
| SMILES | COc1cccc(OC)c1-n1c(/C=C\C(=O)O)nnc1-c1ccc(C)o1 |
| InChI | InChI=1S/C18H17N3O5/c1-11-7-8-14(26-11)18-20-19-15(9-10-16(22)23)21(18)17-12(24-2)5-4-6-13(17)25-3/h4-10H,1-3H3,(H,22,23)/b10-9- |
| InChIKey | GODSZENMGAUKFR-KTKRTIGZSA-N |
| XLogP | 2.95 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|