C20H24Cl2F3N5O2 — CID 135341122
1-[3-[4-[2-[4,5-dichloro-2-(2,2,2-trifluoroethylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 135341122) has the molecular formula C20H24Cl2F3N5O2 and a molecular weight of 494.35 g/mol. Its IUPAC name is 1-[3-[4-[2-[4,5-dichloro-2-(2,2,2-trifluoroethylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[2-[4,5-dichloro-2-(2,2,2-trifluoroethylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135341122 |
| Molecular Formula | C20H24Cl2F3N5O2 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-[3-[4-[2-[4,5-dichloro-2-(2,2,2-trifluoroethylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3NCC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C20H24Cl2F3N5O2/c1-2-18(31)30-10-13(11-30)28-3-5-29(6-4-28)19(32)9-26-16-7-14(21)15(22)8-17(16)27-12-20(23,24)25/h2,7-8,13,26-27H,1,3-6,9-12H2 |
| InChIKey | HEDSGIZUVYRPBB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|