C21H24Cl2N6O3 — CID 135341146
1-[3-[4-[2-[4,5-dichloro-2-(1,3-oxazol-2-ylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 135341146) has the molecular formula C21H24Cl2N6O3 and a molecular weight of 479.37 g/mol. Its IUPAC name is 1-[3-[4-[2-[4,5-dichloro-2-(1,3-oxazol-2-ylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-[2-[4,5-dichloro-2-(1,3-oxazol-2-ylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135341146 |
| Molecular Formula | C21H24Cl2N6O3 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-[3-[4-[2-[4,5-dichloro-2-(1,3-oxazol-2-ylamino)anilino]acetyl]piperazin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CCN(C(=O)CNc3cc(Cl)c(Cl)cc3Nc3ncco3)CC2)C1 |
| InChI | InChI=1S/C21H24Cl2N6O3/c1-2-19(30)29-12-14(13-29)27-4-6-28(7-5-27)20(31)11-25-17-9-15(22)16(23)10-18(17)26-21-24-3-8-32-21/h2-3,8-10,14,25H,1,4-7,11-13H2,(H,24,26) |
| InChIKey | XMIPQLCHDKKEQY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|