C16H19F5N4O4 — CID 135342031
tert-butyl 6-[4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 135342031) has the molecular formula C16H19F5N4O4 and a molecular weight of 426.34 g/mol. Its IUPAC name is tert-butyl 6-[4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 135342031 |
| Molecular Formula | C16H19F5N4O4 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | tert-butyl 6-[4-nitro-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(n3cc([N+](=O)[O-])c(C(F)(F)C(F)(F)F)n3)C2)C1 |
| InChI | InChI=1S/C16H19F5N4O4/c1-13(2,3)29-12(26)23-7-14(8-23)4-9(5-14)24-6-10(25(27)28)11(22-24)15(17,18)16(19,20)21/h6,9H,4-5,7-8H2,1-3H3 |
| InChIKey | ZJXBKOJFYRUGCE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|