About 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine
4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine (PubChem CID 135342083) has the molecular formula C15H21F3N4O4
and a molecular weight of 378.35 g/mol. Its IUPAC name is 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine.
Molecular Properties
| Compound Name | 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine |
| PubChem CID | 135342083 |
| Molecular Formula | C15H21F3N4O4 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine |
| SMILES | O=[N+]([O-])c1cn(C2CCN(C3CCOCC3)CC2)nc1OCC(F)(F)F |
| InChI | InChI=1S/C15H21F3N4O4/c16-15(17,18)10-26-14-13(22(23)24)9-21(19-14)12-1-5-20(6-2-12)11-3-7-25-8-4-11/h9,11-12H,1-8,10H2 |
| InChIKey | NBMRGXRAOGYHQR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine?
The IUPAC name of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine (CID 135342083) is 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine.
What is the SMILES notation for 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine?
The canonical SMILES for 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine is O=[N+]([O-])c1cn(C2CCN(C3CCOCC3)CC2)nc1OCC(F)(F)F.
What is the InChIKey of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine?
The InChIKey is NBMRGXRAOGYHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N4O4/c16-15(17,18)10-26-14-13(22(23)24)9-21(19-14)12-1-5-20(6-2-12)11-3-7-25-8-4-11/h9,11-12H,1-8,10H2.
What are the key properties of 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine?
4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine has a molecular weight of 378.35 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-nitro-3-(2,2,2-trifluoroethoxy)pyrazol-1-yl]-1-(oxan-4-yl)piperidine is sourced from PubChem (CID 135342083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).